C21H24N2O4 — CID 139076959
(2S,3R,6R)-3-ethyl-2,6-bis(4-methoxyphenyl)-1-nitrosopiperidin-4-one (PubChem CID 139076959) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (2S,3R,6R)-3-ethyl-2,6-bis(4-methoxyphenyl)-1-nitrosopiperidin-4-one.
| Compound Name | (2S,3R,6R)-3-ethyl-2,6-bis(4-methoxyphenyl)-1-nitrosopiperidin-4-one |
|---|---|
| PubChem CID | 139076959 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (2S,3R,6R)-3-ethyl-2,6-bis(4-methoxyphenyl)-1-nitrosopiperidin-4-one |
| SMILES | CC[C@H]1C(=O)C[C@H](c2ccc(OC)cc2)N(N=O)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-4-18-20(24)13-19(14-5-9-16(26-2)10-6-14)23(22-25)21(18)15-7-11-17(27-3)12-8-15/h5-12,18-19,21H,4,13H2,1-3H3/t18-,19+,21+/m0/s1 |
| InChIKey | RWQFCSBWZFXGTK-QKNQBKEWSA-N |
| XLogP | 4.47 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|