C16H19NO5 — CID 46188100
ethyl (E)-3-methyl-5-[(2S,3S)-3-(4-nitrophenyl)oxiran-2-yl]pent-2-enoate (PubChem CID 46188100) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl (E)-3-methyl-5-[(2S,3S)-3-(4-nitrophenyl)oxiran-2-yl]pent-2-enoate.
| Compound Name | ethyl (E)-3-methyl-5-[(2S,3S)-3-(4-nitrophenyl)oxiran-2-yl]pent-2-enoate |
|---|---|
| PubChem CID | 46188100 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | ethyl (E)-3-methyl-5-[(2S,3S)-3-(4-nitrophenyl)oxiran-2-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)CC[C@@H]1O[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H19NO5/c1-3-21-15(18)10-11(2)4-9-14-16(22-14)12-5-7-13(8-6-12)17(19)20/h5-8,10,14,16H,3-4,9H2,1-2H3/b11-10+/t14-,16-/m0/s1 |
| InChIKey | BVOSUAKSQQWXAR-BJCHZKIZSA-N |
| XLogP | 3.32 |
| TPSA | 81.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|