C12H12N2O5 — CID 15501175
ethyl 5-(4-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 15501175) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is ethyl 5-(4-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(4-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 15501175 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | ethyl 5-(4-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)C1N=COC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N2O5/c1-2-18-12(15)10-11(19-7-13-10)8-3-5-9(6-4-8)14(16)17/h3-7,10-11H,2H2,1H3 |
| InChIKey | YQXIGFHFDLPEIL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|