C20H23NO4 — CID 101207472
ethyl (1R,6S,7R,8R)-1,3,5-trimethyl-8-(4-nitrophenyl)bicyclo[4.2.0]octa-2,4-diene-7-carboxylate (PubChem CID 101207472) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl (1R,6S,7R,8R)-1,3,5-trimethyl-8-(4-nitrophenyl)bicyclo[4.2.0]octa-2,4-diene-7-carboxylate.
| Compound Name | ethyl (1R,6S,7R,8R)-1,3,5-trimethyl-8-(4-nitrophenyl)bicyclo[4.2.0]octa-2,4-diene-7-carboxylate |
|---|---|
| PubChem CID | 101207472 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | ethyl (1R,6S,7R,8R)-1,3,5-trimethyl-8-(4-nitrophenyl)bicyclo[4.2.0]octa-2,4-diene-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(C)=CC(C)=C[C@@]2(C)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H23NO4/c1-5-25-19(22)16-17-13(3)10-12(2)11-20(17,4)18(16)14-6-8-15(9-7-14)21(23)24/h6-11,16-18H,5H2,1-4H3/t16-,17-,18+,20-/m1/s1 |
| InChIKey | RSQUWTMIVQKIGN-FTEYMNFISA-N |
| XLogP | 4.40 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|