C15H20N2O4 — CID 134985601
ethyl (2R,3S)-1-butyl-3-(4-nitrophenyl)aziridine-2-carboxylate (PubChem CID 134985601) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is ethyl (2R,3S)-1-butyl-3-(4-nitrophenyl)aziridine-2-carboxylate.
| Compound Name | ethyl (2R,3S)-1-butyl-3-(4-nitrophenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 134985601 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl (2R,3S)-1-butyl-3-(4-nitrophenyl)aziridine-2-carboxylate |
| SMILES | CCCCN1[C@@H](C(=O)OCC)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-3-5-10-16-13(14(16)15(18)21-4-2)11-6-8-12(9-7-11)17(19)20/h6-9,13-14H,3-5,10H2,1-2H3/t13-,14+,16?/m0/s1 |
| InChIKey | HCLKRHBJPVWFHT-NNKZFNQJSA-N |
| XLogP | 2.68 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|