C23H24N4O5 — CID 17229424
ethyl 1-butyl-4-(4-nitrophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 17229424) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is ethyl 1-butyl-4-(4-nitrophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl 1-butyl-4-(4-nitrophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 17229424 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | ethyl 1-butyl-4-(4-nitrophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCCCN1C(=O)C(C(=O)OCC)C(c2ccc([N+](=O)[O-])cc2)n2c1nc1ccccc12 |
| InChI | InChI=1S/C23H24N4O5/c1-3-5-14-25-21(28)19(22(29)32-4-2)20(15-10-12-16(13-11-15)27(30)31)26-18-9-7-6-8-17(18)24-23(25)26/h6-13,19-20H,3-5,14H2,1-2H3 |
| InChIKey | IPHGOTITXFZFKG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|