C14H16N2O6 — CID 177440482
ethyl (1S,2R,3S)-2-(hydroxymethyl)-3-[(4-nitrophenyl)carbamoyl]cyclopropane-1-carboxylate (PubChem CID 177440482) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is ethyl (1S,2R,3S)-2-(hydroxymethyl)-3-[(4-nitrophenyl)carbamoyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3S)-2-(hydroxymethyl)-3-[(4-nitrophenyl)carbamoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 177440482 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | ethyl (1S,2R,3S)-2-(hydroxymethyl)-3-[(4-nitrophenyl)carbamoyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](CO)[C@@H]1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H16N2O6/c1-2-22-14(19)12-10(7-17)11(12)13(18)15-8-3-5-9(6-4-8)16(20)21/h3-6,10-12,17H,2,7H2,1H3,(H,15,18)/t10-,11+,12+/m1/s1 |
| InChIKey | BCIPWYGJRLTZCU-WOPDTQHZSA-N |
| XLogP | 0.95 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|