C22H22N2O7 — CID 11091216
diethyl (2R,6S)-2-(4-nitrophenyl)-4-phenyl-3,6-dihydro-2H-1,3-oxazine-5,6-dicarboxylate (PubChem CID 11091216) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is diethyl (2R,6S)-2-(4-nitrophenyl)-4-phenyl-3,6-dihydro-2H-1,3-oxazine-5,6-dicarboxylate.
| Compound Name | diethyl (2R,6S)-2-(4-nitrophenyl)-4-phenyl-3,6-dihydro-2H-1,3-oxazine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 11091216 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | diethyl (2R,6S)-2-(4-nitrophenyl)-4-phenyl-3,6-dihydro-2H-1,3-oxazine-5,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N[C@@H](c2ccc([N+](=O)[O-])cc2)O[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C22H22N2O7/c1-3-29-21(25)17-18(14-8-6-5-7-9-14)23-20(31-19(17)22(26)30-4-2)15-10-12-16(13-11-15)24(27)28/h5-13,19-20,23H,3-4H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | HYGVMZCIXKIWTN-VQTJNVASSA-N |
| XLogP | 3.12 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|