C20H25N2O9P — CID 23416862
2,2,2-triethoxy-4,5-bis(4-nitrophenyl)-1,3,2λ5-dioxaphospholane (PubChem CID 23416862) has the molecular formula C20H25N2O9P and a molecular weight of 468.40 g/mol. Its IUPAC name is 2,2,2-triethoxy-4,5-bis(4-nitrophenyl)-1,3,2λ5-dioxaphospholane.
| Compound Name | 2,2,2-triethoxy-4,5-bis(4-nitrophenyl)-1,3,2λ5-dioxaphospholane |
|---|---|
| PubChem CID | 23416862 |
| Molecular Formula | C20H25N2O9P |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2,2,2-triethoxy-4,5-bis(4-nitrophenyl)-1,3,2λ5-dioxaphospholane |
| SMILES | CCOP1(OCC)(OCC)OC(c2ccc([N+](=O)[O-])cc2)C(c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C20H25N2O9P/c1-4-27-32(28-5-2,29-6-3)30-19(15-7-11-17(12-8-15)21(23)24)20(31-32)16-9-13-18(14-10-16)22(25)26/h7-14,19-20H,4-6H2,1-3H3 |
| InChIKey | CGECCNAWGBWGFX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 132.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|