C18H19N2O6P — CID 12966879
(2S,5S)-1-ethoxy-2,5-bis(4-nitrophenyl)-1lambda5-phospholane 1-oxide (PubChem CID 12966879) has the molecular formula C18H19N2O6P and a molecular weight of 390.33 g/mol. Its IUPAC name is (2S,5S)-1-ethoxy-2,5-bis(4-nitrophenyl)-1lambda5-phospholane 1-oxide.
| Compound Name | (2S,5S)-1-ethoxy-2,5-bis(4-nitrophenyl)-1lambda5-phospholane 1-oxide |
|---|---|
| PubChem CID | 12966879 |
| Molecular Formula | C18H19N2O6P |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (2S,5S)-1-ethoxy-2,5-bis(4-nitrophenyl)-1lambda5-phospholane 1-oxide |
| SMILES | CCOP1(=O)[C@H](c2ccc([N+](=O)[O-])cc2)CC[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N2O6P/c1-2-26-27(25)17(13-3-7-15(8-4-13)19(21)22)11-12-18(27)14-5-9-16(10-6-14)20(23)24/h3-10,17-18H,2,11-12H2,1H3/t17-,18-/m0/s1 |
| InChIKey | GHJBOGOSGJMLNW-ROUUACIJSA-N |
| XLogP | 5.39 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|