C17H15NO4S — CID 7288244
(2S,4R)-2-(3-benzoyloxyphenyl)-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 7288244) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is (2S,4R)-2-(3-benzoyloxyphenyl)-1,3-thiazolidin-3-ium-4-carboxylate.
| Compound Name | (2S,4R)-2-(3-benzoyloxyphenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 7288244 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (2S,4R)-2-(3-benzoyloxyphenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | O=C(Oc1cccc([C@H]2[NH2+][C@H](C(=O)[O-])CS2)c1)c1ccccc1 |
| InChI | InChI=1S/C17H15NO4S/c19-16(20)14-10-23-15(18-14)12-7-4-8-13(9-12)22-17(21)11-5-2-1-3-6-11/h1-9,14-15,18H,10H2,(H,19,20)/t14-,15-/m0/s1 |
| InChIKey | IUHBNOBWZKFEHP-GJZGRUSLSA-N |
| XLogP | 0.33 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|