C10H9Cl2NO2S — CID 4111322
2-(3,4-dichlorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 4111322) has the molecular formula C10H9Cl2NO2S and a molecular weight of 278.16 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate.
| Compound Name | 2-(3,4-dichlorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 4111322 |
| Molecular Formula | C10H9Cl2NO2S |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | O=C([O-])C1CSC(c2ccc(Cl)c(Cl)c2)[NH2+]1 |
| InChI | InChI=1S/C10H9Cl2NO2S/c11-6-2-1-5(3-7(6)12)9-13-8(4-16-9)10(14)15/h1-3,8-9,13H,4H2,(H,14,15) |
| InChIKey | JFVLZAPPBGHGBP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |