C5H6NO4S- — CID 7062204
(2R,4R)-1,3-thiazolidin-3-ium-2,4-dicarboxylate (PubChem CID 7062204) has the molecular formula C5H6NO4S- and a molecular weight of 176.17 g/mol. Its IUPAC name is (2R,4R)-1,3-thiazolidin-3-ium-2,4-dicarboxylate.
| Compound Name | (2R,4R)-1,3-thiazolidin-3-ium-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7062204 |
| Molecular Formula | C5H6NO4S- |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | (2R,4R)-1,3-thiazolidin-3-ium-2,4-dicarboxylate |
| SMILES | O=C([O-])[C@@H]1CS[C@H](C(=O)[O-])[NH2+]1 |
| InChI | InChI=1S/C5H7NO4S/c7-4(8)2-1-11-3(6-2)5(9)10/h2-3,6H,1H2,(H,7,8)(H,9,10)/p-1/t2-,3+/m0/s1 |
| InChIKey | DAXBISKSIDBYEU-STHAYSLISA-M |
| XLogP | -4.51 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |