C9H17NO7S — CID 7200753
(2S,4R)-2-[(1R,2R,3S,4S)-1,2,3,4,5-pentahydroxypentyl]-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 7200753) has the molecular formula C9H17NO7S and a molecular weight of 283.30 g/mol. Its IUPAC name is (2S,4R)-2-[(1R,2R,3S,4S)-1,2,3,4,5-pentahydroxypentyl]-1,3-thiazolidin-3-ium-4-carboxylate.
| Compound Name | (2S,4R)-2-[(1R,2R,3S,4S)-1,2,3,4,5-pentahydroxypentyl]-1,3-thiazolidin-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 7200753 |
| Molecular Formula | C9H17NO7S |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (2S,4R)-2-[(1R,2R,3S,4S)-1,2,3,4,5-pentahydroxypentyl]-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | O=C([O-])[C@@H]1CS[C@@H]([C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO)[NH2+]1 |
| InChI | InChI=1S/C9H17NO7S/c11-1-4(12)5(13)6(14)7(15)8-10-3(2-18-8)9(16)17/h3-8,10-15H,1-2H2,(H,16,17)/t3-,4-,5-,6+,7+,8-/m0/s1 |
| InChIKey | JEPVUMTVFPQKQE-OERFOPOVSA-N |
| XLogP | -5.82 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | -5.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |