C10H17NO2S — CID 7853346
(2R,4S)-2-cyclohexyl-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 7853346) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is (2R,4S)-2-cyclohexyl-1,3-thiazolidin-3-ium-4-carboxylate.
| Compound Name | (2R,4S)-2-cyclohexyl-1,3-thiazolidin-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 7853346 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | (2R,4S)-2-cyclohexyl-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | O=C([O-])[C@H]1CS[C@H](C2CCCCC2)[NH2+]1 |
| InChI | InChI=1S/C10H17NO2S/c12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h7-9,11H,1-6H2,(H,12,13)/t8-,9-/m1/s1 |
| InChIKey | NGEBHQSOFHCRQW-RKDXNWHRSA-N |
| XLogP | -0.68 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |