C10H10BrNO2S — CID 6929037
(2S,4R)-2-(3-bromophenyl)-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 6929037) has the molecular formula C10H10BrNO2S and a molecular weight of 288.17 g/mol. Its IUPAC name is (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidin-3-ium-4-carboxylate.
| Compound Name | (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 6929037 |
| Molecular Formula | C10H10BrNO2S |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | (2S,4R)-2-(3-bromophenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | O=C([O-])[C@@H]1CS[C@@H](c2cccc(Br)c2)[NH2+]1 |
| InChI | InChI=1S/C10H10BrNO2S/c11-7-3-1-2-6(4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | LZVZEQCJORCGOK-IUCAKERBSA-N |
| XLogP | -0.12 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |