C11H12BrNO3S — CID 5080963
2-(5-bromo-2-methoxyphenyl)-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 5080963) has the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-1,3-thiazolidin-3-ium-4-carboxylate.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 5080963 |
| Molecular Formula | C11H12BrNO3S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | COc1ccc(Br)cc1C1[NH2+]C(C(=O)[O-])CS1 |
| InChI | InChI=1S/C11H12BrNO3S/c1-16-9-3-2-6(12)4-7(9)10-13-8(5-17-10)11(14)15/h2-4,8,10,13H,5H2,1H3,(H,14,15) |
| InChIKey | XIIXYYUMGBJWCR-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |