C13H18N2O3 — CID 10037741
(3S,4R,5S)-5-methyl-4-nitro-3-phenyl-2-propan-2-yl-1,2-oxazolidine (PubChem CID 10037741) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (3S,4R,5S)-5-methyl-4-nitro-3-phenyl-2-propan-2-yl-1,2-oxazolidine.
| Compound Name | (3S,4R,5S)-5-methyl-4-nitro-3-phenyl-2-propan-2-yl-1,2-oxazolidine |
|---|---|
| PubChem CID | 10037741 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (3S,4R,5S)-5-methyl-4-nitro-3-phenyl-2-propan-2-yl-1,2-oxazolidine |
| SMILES | CC(C)N1O[C@@H](C)[C@H]([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H18N2O3/c1-9(2)14-13(11-7-5-4-6-8-11)12(15(16)17)10(3)18-14/h4-10,12-13H,1-3H3/t10-,12-,13-/m0/s1 |
| InChIKey | IBNHMCKGGUNWMQ-DRZSPHRISA-N |
| XLogP | 2.42 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|