C16H21NO3 — CID 102259797
(2R,3S,4R,6S)-4-ethenyl-3-nitro-6-phenyl-2-propan-2-yloxane (PubChem CID 102259797) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (2R,3S,4R,6S)-4-ethenyl-3-nitro-6-phenyl-2-propan-2-yloxane.
| Compound Name | (2R,3S,4R,6S)-4-ethenyl-3-nitro-6-phenyl-2-propan-2-yloxane |
|---|---|
| PubChem CID | 102259797 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2R,3S,4R,6S)-4-ethenyl-3-nitro-6-phenyl-2-propan-2-yloxane |
| SMILES | C=C[C@H]1C[C@@H](c2ccccc2)O[C@H](C(C)C)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21NO3/c1-4-12-10-14(13-8-6-5-7-9-13)20-16(11(2)3)15(12)17(18)19/h4-9,11-12,14-16H,1,10H2,2-3H3/t12-,14-,15-,16+/m0/s1 |
| InChIKey | ACLINLOVIQXTNT-QCEMKRCNSA-N |
| XLogP | 3.62 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|