C21H36O2Si2 — CID 102519223
[(3R,4R,6S)-3-ethenyl-6-phenyl-2,2-di(propan-2-yl)oxasilinan-4-yl]oxy-trimethylsilane (PubChem CID 102519223) has the molecular formula C21H36O2Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is [(3R,4R,6S)-3-ethenyl-6-phenyl-2,2-di(propan-2-yl)oxasilinan-4-yl]oxy-trimethylsilane.
| Compound Name | [(3R,4R,6S)-3-ethenyl-6-phenyl-2,2-di(propan-2-yl)oxasilinan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 102519223 |
| Molecular Formula | C21H36O2Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [(3R,4R,6S)-3-ethenyl-6-phenyl-2,2-di(propan-2-yl)oxasilinan-4-yl]oxy-trimethylsilane |
| SMILES | C=C[C@@H]1[C@H](O[Si](C)(C)C)C[C@@H](c2ccccc2)O[Si]1(C(C)C)C(C)C |
| InChI | InChI=1S/C21H36O2Si2/c1-9-21-20(22-24(6,7)8)15-19(18-13-11-10-12-14-18)23-25(21,16(2)3)17(4)5/h9-14,16-17,19-21H,1,15H2,2-8H3/t19-,20+,21+/m0/s1 |
| InChIKey | FRMNRYCOFHYUCM-PWRODBHTSA-N |
| XLogP | 6.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|