C19H32O2Si2 — CID 11428026
[(3R,4R,6S)-3-ethenyl-2,2-diethyl-6-phenyloxasilinan-4-yl]oxy-trimethylsilane (PubChem CID 11428026) has the molecular formula C19H32O2Si2 and a molecular weight of 348.63 g/mol. Its IUPAC name is [(3R,4R,6S)-3-ethenyl-2,2-diethyl-6-phenyloxasilinan-4-yl]oxy-trimethylsilane.
| Compound Name | [(3R,4R,6S)-3-ethenyl-2,2-diethyl-6-phenyloxasilinan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11428026 |
| Molecular Formula | C19H32O2Si2 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(3R,4R,6S)-3-ethenyl-2,2-diethyl-6-phenyloxasilinan-4-yl]oxy-trimethylsilane |
| SMILES | C=C[C@@H]1[C@H](O[Si](C)(C)C)C[C@@H](c2ccccc2)O[Si]1(CC)CC |
| InChI | InChI=1S/C19H32O2Si2/c1-7-19-18(20-22(4,5)6)15-17(16-13-11-10-12-14-16)21-23(19,8-2)9-3/h7,10-14,17-19H,1,8-9,15H2,2-6H3/t17-,18+,19+/m0/s1 |
| InChIKey | FHLHPSISOUDXNX-IPMKNSEASA-N |
| XLogP | 5.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|