C34H42O5Si — CID 11444345
(3R,3aR,5R,6R,7S,7aS)-3-ethenyl-2,2-diethyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydrooxasilolo[4,5-b]pyran (PubChem CID 11444345) has the molecular formula C34H42O5Si and a molecular weight of 558.79 g/mol. Its IUPAC name is (3R,3aR,5R,6R,7S,7aS)-3-ethenyl-2,2-diethyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydrooxasilolo[4,5-b]pyran.
| Compound Name | (3R,3aR,5R,6R,7S,7aS)-3-ethenyl-2,2-diethyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydrooxasilolo[4,5-b]pyran |
|---|---|
| PubChem CID | 11444345 |
| Molecular Formula | C34H42O5Si |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | (3R,3aR,5R,6R,7S,7aS)-3-ethenyl-2,2-diethyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydrooxasilolo[4,5-b]pyran |
| SMILES | C=C[C@@H]1[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2O[Si]1(CC)CC |
| InChI | InChI=1S/C34H42O5Si/c1-4-30-32-34(39-40(30,5-2)6-3)33(37-24-28-20-14-9-15-21-28)31(36-23-27-18-12-8-13-19-27)29(38-32)25-35-22-26-16-10-7-11-17-26/h4,7-21,29-34H,1,5-6,22-25H2,2-3H3/t29-,30-,31-,32+,33+,34-/m1/s1 |
| InChIKey | YSVZHBAGIFOISS-MRIQVRTJSA-N |
| XLogP | 7.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|