C16H22O2Si — CID 24807343
(4R,6S)-3-ethenylidene-2,2-diethyl-6-phenyloxasilinan-4-ol (PubChem CID 24807343) has the molecular formula C16H22O2Si and a molecular weight of 274.44 g/mol. Its IUPAC name is (4R,6S)-3-ethenylidene-2,2-diethyl-6-phenyloxasilinan-4-ol.
| Compound Name | (4R,6S)-3-ethenylidene-2,2-diethyl-6-phenyloxasilinan-4-ol |
|---|---|
| PubChem CID | 24807343 |
| Molecular Formula | C16H22O2Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (4R,6S)-3-ethenylidene-2,2-diethyl-6-phenyloxasilinan-4-ol |
| SMILES | C=C=C1[C@H](O)C[C@@H](c2ccccc2)O[Si]1(CC)CC |
| InChI | InChI=1S/C16H22O2Si/c1-4-16-14(17)12-15(13-10-8-7-9-11-13)18-19(16,5-2)6-3/h7-11,14-15,17H,1,5-6,12H2,2-3H3/t14-,15+/m1/s1 |
| InChIKey | JUADXEIQSPAJTD-CABCVRRESA-N |
| XLogP | 3.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|