C17H28O3Si2 — CID 11515552
[(4R,6S)-3-ethenylidene-2,2-diethyl-6-(furan-2-yl)oxasilinan-4-yl]oxy-trimethylsilane (PubChem CID 11515552) has the molecular formula C17H28O3Si2 and a molecular weight of 336.58 g/mol. Its IUPAC name is [(4R,6S)-3-ethenylidene-2,2-diethyl-6-(furan-2-yl)oxasilinan-4-yl]oxy-trimethylsilane.
| Compound Name | [(4R,6S)-3-ethenylidene-2,2-diethyl-6-(furan-2-yl)oxasilinan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11515552 |
| Molecular Formula | C17H28O3Si2 |
| Molecular Weight | 336.58 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(4R,6S)-3-ethenylidene-2,2-diethyl-6-(furan-2-yl)oxasilinan-4-yl]oxy-trimethylsilane |
| SMILES | C=C=C1[C@H](O[Si](C)(C)C)C[C@@H](c2ccco2)O[Si]1(CC)CC |
| InChI | InChI=1S/C17H28O3Si2/c1-7-17-16(19-21(4,5)6)13-15(14-11-10-12-18-14)20-22(17,8-2)9-3/h10-12,15-16H,1,8-9,13H2,2-6H3/t15-,16+/m0/s1 |
| InChIKey | JLFBNOPMZXXKLS-JKSUJKDBSA-N |
| XLogP | 5.20 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|