C30H50O6Si2 — CID 12027174
(4S,6R)-2,2-ditert-butyl-4-[(4S,6R)-2,2-ditert-butyl-6-(furan-2-yl)-1,3,2-dioxasilinan-4-yl]-6-(furan-2-yl)-1,3,2-dioxasilinane (PubChem CID 12027174) has the molecular formula C30H50O6Si2 and a molecular weight of 562.90 g/mol. Its IUPAC name is (4S,6R)-2,2-ditert-butyl-4-[(4S,6R)-2,2-ditert-butyl-6-(furan-2-yl)-1,3,2-dioxasilinan-4-yl]-6-(furan-2-yl)-1,3,2-dioxasilinane.
| Compound Name | (4S,6R)-2,2-ditert-butyl-4-[(4S,6R)-2,2-ditert-butyl-6-(furan-2-yl)-1,3,2-dioxasilinan-4-yl]-6-(furan-2-yl)-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 12027174 |
| Molecular Formula | C30H50O6Si2 |
| Molecular Weight | 562.90 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | (4S,6R)-2,2-ditert-butyl-4-[(4S,6R)-2,2-ditert-butyl-6-(furan-2-yl)-1,3,2-dioxasilinan-4-yl]-6-(furan-2-yl)-1,3,2-dioxasilinane |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)O[C@H]([C@@H]2C[C@H](c3ccco3)O[Si](C(C)(C)C)(C(C)(C)C)O2)C[C@H](c2ccco2)O1 |
| InChI | InChI=1S/C30H50O6Si2/c1-27(2,3)37(28(4,5)6)33-23(21-15-13-17-31-21)19-25(35-37)26-20-24(22-16-14-18-32-22)34-38(36-26,29(7,8)9)30(10,11)12/h13-18,23-26H,19-20H2,1-12H3/t23-,24-,25+,26+/m1/s1 |
| InChIKey | DFACXQFFZGPLGN-XPGKHFPBSA-N |
| XLogP | 9.35 |
| TPSA | 63.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.90 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|