C15H18O2 — CID 102157853
3-[(2S,5S)-3-ethenylidene-5-phenyloxolan-2-yl]propan-1-ol (PubChem CID 102157853) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[(2S,5S)-3-ethenylidene-5-phenyloxolan-2-yl]propan-1-ol.
| Compound Name | 3-[(2S,5S)-3-ethenylidene-5-phenyloxolan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 102157853 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-[(2S,5S)-3-ethenylidene-5-phenyloxolan-2-yl]propan-1-ol |
| SMILES | C=C=C1C[C@@H](c2ccccc2)O[C@H]1CCCO |
| InChI | InChI=1S/C15H18O2/c1-2-12-11-15(13-7-4-3-5-8-13)17-14(12)9-6-10-16/h3-5,7-8,14-16H,1,6,9-11H2/t14-,15-/m0/s1 |
| InChIKey | HJSVKROXJHJMRX-GJZGRUSLSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |