C26H39NO4Si — CID 134845849
(3R,4S,7S,9R,11R)-3-ethenyl-9-[(2R)-2-phenylcyclohexyl]oxy-5,5-di(propan-2-yl)-2,6,10-trioxa-1-aza-5-silatricyclo[5.3.1.04,11]undecane (PubChem CID 134845849) has the molecular formula C26H39NO4Si and a molecular weight of 457.69 g/mol. Its IUPAC name is (3R,4S,7S,9R,11R)-3-ethenyl-9-[(2R)-2-phenylcyclohexyl]oxy-5,5-di(propan-2-yl)-2,6,10-trioxa-1-aza-5-silatricyclo[5.3.1.04,11]undecane.
| Compound Name | (3R,4S,7S,9R,11R)-3-ethenyl-9-[(2R)-2-phenylcyclohexyl]oxy-5,5-di(propan-2-yl)-2,6,10-trioxa-1-aza-5-silatricyclo[5.3.1.04,11]undecane |
|---|---|
| PubChem CID | 134845849 |
| Molecular Formula | C26H39NO4Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (3R,4S,7S,9R,11R)-3-ethenyl-9-[(2R)-2-phenylcyclohexyl]oxy-5,5-di(propan-2-yl)-2,6,10-trioxa-1-aza-5-silatricyclo[5.3.1.04,11]undecane |
| SMILES | C=C[C@H]1ON2O[C@@H](OC3CCCC[C@@H]3c3ccccc3)C[C@@H]3O[Si](C(C)C)(C(C)C)[C@H]1[C@@H]32 |
| InChI | InChI=1S/C26H39NO4Si/c1-6-21-26-25-23(31-32(26,17(2)3)18(4)5)16-24(30-27(25)29-21)28-22-15-11-10-14-20(22)19-12-8-7-9-13-19/h6-9,12-13,17-18,20-26H,1,10-11,14-16H2,2-5H3/t20-,21-,22?,23+,24-,25-,26-/m1/s1 |
| InChIKey | RUGIQJNQFNFNCU-ZWQBQKEXSA-N |
| XLogP | 6.10 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|