C26H41NO6Si — CID 10929086
(1R)-1-[(3R,4S,7S,9R,11R)-9-[(1S,2R)-2-phenylcyclohexyl]oxy-5,5-di(propan-2-yl)-2,6,10-trioxa-1-aza-5-silatricyclo[5.3.1.04,11]undecan-3-yl]ethane-1,2-diol (PubChem CID 10929086) has the molecular formula C26H41NO6Si and a molecular weight of 491.70 g/mol. Its IUPAC name is (1R)-1-[(3R,4S,7S,9R,11R)-9-[(1S,2R)-2-phenylcyclohexyl]oxy-5,5-di(propan-2-yl)-2,6,10-trioxa-1-aza-5-silatricyclo[5.3.1.04,11]undecan-3-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3R,4S,7S,9R,11R)-9-[(1S,2R)-2-phenylcyclohexyl]oxy-5,5-di(propan-2-yl)-2,6,10-trioxa-1-aza-5-silatricyclo[5.3.1.04,11]undecan-3-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 10929086 |
| Molecular Formula | C26H41NO6Si |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (1R)-1-[(3R,4S,7S,9R,11R)-9-[(1S,2R)-2-phenylcyclohexyl]oxy-5,5-di(propan-2-yl)-2,6,10-trioxa-1-aza-5-silatricyclo[5.3.1.04,11]undecan-3-yl]ethane-1,2-diol |
| SMILES | CC(C)[Si]1(C(C)C)O[C@H]2C[C@H](O[C@H]3CCCC[C@@H]3c3ccccc3)ON3O[C@H]([C@H](O)CO)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C26H41NO6Si/c1-16(2)34(17(3)4)26-24-22(33-34)14-23(31-27(24)32-25(26)20(29)15-28)30-21-13-9-8-12-19(21)18-10-6-5-7-11-18/h5-7,10-11,16-17,19-26,28-29H,8-9,12-15H2,1-4H3/t19-,20-,21+,22+,23-,24-,25-,26+/m1/s1 |
| InChIKey | GZNKHFICKGHMGH-FJKSZPNDSA-N |
| XLogP | 4.26 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|