C23H31NO7 — CID 11037444
propan-2-yl (3R,4R,7R,9S,11S)-5-hydroxy-9-[(1S,2R)-2-phenylcyclohexyl]oxy-2,6,10-trioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate (PubChem CID 11037444) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is propan-2-yl (3R,4R,7R,9S,11S)-5-hydroxy-9-[(1S,2R)-2-phenylcyclohexyl]oxy-2,6,10-trioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate.
| Compound Name | propan-2-yl (3R,4R,7R,9S,11S)-5-hydroxy-9-[(1S,2R)-2-phenylcyclohexyl]oxy-2,6,10-trioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate |
|---|---|
| PubChem CID | 11037444 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | propan-2-yl (3R,4R,7R,9S,11S)-5-hydroxy-9-[(1S,2R)-2-phenylcyclohexyl]oxy-2,6,10-trioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1ON2O[C@H](O[C@H]3CCCC[C@@H]3c3ccccc3)C[C@H]3OC(O)[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C23H31NO7/c1-13(2)27-23(26)21-19-20-17(29-22(19)25)12-18(30-24(20)31-21)28-16-11-7-6-10-15(16)14-8-4-3-5-9-14/h3-5,8-9,13,15-22,25H,6-7,10-12H2,1-2H3/t15-,16+,17-,18+,19-,20-,21-,22?/m1/s1 |
| InChIKey | DNOPDNSMEYWEHD-DVTWVPISSA-N |
| XLogP | 2.66 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |