C24H26O5 — CID 87273977
bis(1-phenylethyl) 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate (PubChem CID 87273977) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is bis(1-phenylethyl) 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate.
| Compound Name | bis(1-phenylethyl) 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 87273977 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | bis(1-phenylethyl) 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| SMILES | CC(OC(=O)C1CC2OC2CC1C(=O)OC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26O5/c1-15(17-9-5-3-6-10-17)27-23(25)19-13-21-22(29-21)14-20(19)24(26)28-16(2)18-11-7-4-8-12-18/h3-12,15-16,19-22H,13-14H2,1-2H3 |
| InChIKey | CFMROPDKPKNGMJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|