C19H21NO2 — CID 134939139
[(1R)-1-phenylethyl] (2R)-1-[(1R)-1-phenylethyl]aziridine-2-carboxylate (PubChem CID 134939139) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] (2R)-1-[(1R)-1-phenylethyl]aziridine-2-carboxylate.
| Compound Name | [(1R)-1-phenylethyl] (2R)-1-[(1R)-1-phenylethyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 134939139 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [(1R)-1-phenylethyl] (2R)-1-[(1R)-1-phenylethyl]aziridine-2-carboxylate |
| SMILES | C[C@H](c1ccccc1)N1C[C@@H]1C(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H21NO2/c1-14(16-9-5-3-6-10-16)20-13-18(20)19(21)22-15(2)17-11-7-4-8-12-17/h3-12,14-15,18H,13H2,1-2H3/t14-,15-,18-,20?/m1/s1 |
| InChIKey | JJCQCRAKWPKCNO-JIIKTZOOSA-N |
| XLogP | 3.74 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|