C12H12O2 — CID 71408121
(3R,5R)-3-ethenyl-5-phenyloxolan-2-one (PubChem CID 71408121) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (3R,5R)-3-ethenyl-5-phenyloxolan-2-one.
| Compound Name | (3R,5R)-3-ethenyl-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 71408121 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (3R,5R)-3-ethenyl-5-phenyloxolan-2-one |
| SMILES | C=C[C@H]1C[C@H](c2ccccc2)OC1=O |
| InChI | InChI=1S/C12H12O2/c1-2-9-8-11(14-12(9)13)10-6-4-3-5-7-10/h2-7,9,11H,1,8H2/t9-,11+/m0/s1 |
| InChIKey | FIXVOZNYPUHZAQ-GXSJLCMTSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|