C22H19NO4 — CID 122215448
(2R,3R,4S)-4-ethenyl-2-(4-methylphenyl)-3-nitrospiro[cyclopentane-1,2'-indene]-1',3'-dione (PubChem CID 122215448) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (2R,3R,4S)-4-ethenyl-2-(4-methylphenyl)-3-nitrospiro[cyclopentane-1,2'-indene]-1',3'-dione.
| Compound Name | (2R,3R,4S)-4-ethenyl-2-(4-methylphenyl)-3-nitrospiro[cyclopentane-1,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 122215448 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2R,3R,4S)-4-ethenyl-2-(4-methylphenyl)-3-nitrospiro[cyclopentane-1,2'-indene]-1',3'-dione |
| SMILES | C=C[C@@H]1CC2(C(=O)c3ccccc3C2=O)[C@@H](c2ccc(C)cc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19NO4/c1-3-14-12-22(20(24)16-6-4-5-7-17(16)21(22)25)18(19(14)23(26)27)15-10-8-13(2)9-11-15/h3-11,14,18-19H,1,12H2,2H3/t14-,18+,19-/m1/s1 |
| InChIKey | AWWBNTGMWHSZKW-MDASCCDHSA-N |
| XLogP | 4.00 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|