C12H13NO3 — CID 135041702
(2R,3R,4R)-4-ethenyl-3-nitro-2-phenyloxolane (PubChem CID 135041702) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2R,3R,4R)-4-ethenyl-3-nitro-2-phenyloxolane.
| Compound Name | (2R,3R,4R)-4-ethenyl-3-nitro-2-phenyloxolane |
|---|---|
| PubChem CID | 135041702 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2R,3R,4R)-4-ethenyl-3-nitro-2-phenyloxolane |
| SMILES | C=C[C@H]1CO[C@H](c2ccccc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13NO3/c1-2-9-8-16-12(11(9)13(14)15)10-6-4-3-5-7-10/h2-7,9,11-12H,1,8H2/t9-,11+,12+/m0/s1 |
| InChIKey | FVLQAHQKPKZKPT-MVWJERBFSA-N |
| XLogP | 2.21 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|