C21H20O5 — CID 11428114
(4S,5R)-4-[(2S,5S,6S)-5,6-diphenyl-1,4-dioxan-2-yl]-5-ethenyl-1,3-dioxolan-2-one (PubChem CID 11428114) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is (4S,5R)-4-[(2S,5S,6S)-5,6-diphenyl-1,4-dioxan-2-yl]-5-ethenyl-1,3-dioxolan-2-one.
| Compound Name | (4S,5R)-4-[(2S,5S,6S)-5,6-diphenyl-1,4-dioxan-2-yl]-5-ethenyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 11428114 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (4S,5R)-4-[(2S,5S,6S)-5,6-diphenyl-1,4-dioxan-2-yl]-5-ethenyl-1,3-dioxolan-2-one |
| SMILES | C=C[C@H]1OC(=O)O[C@@H]1[C@@H]1CO[C@@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C21H20O5/c1-2-16-20(26-21(22)25-16)17-13-23-18(14-9-5-3-6-10-14)19(24-17)15-11-7-4-8-12-15/h2-12,16-20H,1,13H2/t16-,17+,18+,19+,20+/m1/s1 |
| InChIKey | ASNJIXHXQYAWED-DEPCRRQNSA-N |
| XLogP | 3.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|