C17H22O5 — CID 16742818
(2R,4aR,6S,7S,8R,8aR)-2-ethenyl-7,8-dimethoxy-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 16742818) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-2-ethenyl-7,8-dimethoxy-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-2-ethenyl-7,8-dimethoxy-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 16742818 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-2-ethenyl-7,8-dimethoxy-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C=C[C@@H]1OC[C@H]2O[C@@H](c3ccccc3)[C@H](OC)[C@@H](OC)[C@@H]2O1 |
| InChI | InChI=1S/C17H22O5/c1-4-13-20-10-12-15(22-13)17(19-3)16(18-2)14(21-12)11-8-6-5-7-9-11/h4-9,12-17H,1,10H2,2-3H3/t12-,13-,14+,15-,16+,17+/m1/s1 |
| InChIKey | MDIACWKWUPNGTN-JHMPBIJASA-N |
| XLogP | 2.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|