C22H18O3 — CID 132534184
(1S,2S,5R)-5-ethenyl-1',3'-dioxo-2-phenylspiro[cyclopentane-3,2'-indene]-1-carbaldehyde (PubChem CID 132534184) has the molecular formula C22H18O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is (1S,2S,5R)-5-ethenyl-1',3'-dioxo-2-phenylspiro[cyclopentane-3,2'-indene]-1-carbaldehyde.
| Compound Name | (1S,2S,5R)-5-ethenyl-1',3'-dioxo-2-phenylspiro[cyclopentane-3,2'-indene]-1-carbaldehyde |
|---|---|
| PubChem CID | 132534184 |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (1S,2S,5R)-5-ethenyl-1',3'-dioxo-2-phenylspiro[cyclopentane-3,2'-indene]-1-carbaldehyde |
| SMILES | C=C[C@H]1CC2(C(=O)c3ccccc3C2=O)[C@H](c2ccccc2)[C@H]1C=O |
| InChI | InChI=1S/C22H18O3/c1-2-14-12-22(19(18(14)13-23)15-8-4-3-5-9-15)20(24)16-10-6-7-11-17(16)21(22)25/h2-11,13-14,18-19H,1,12H2/t14-,18-,19+/m0/s1 |
| InChIKey | CSFHORTVENAEQW-ZOCIIQOWSA-N |
| XLogP | 3.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|