C26H20O4 — CID 102573460
(2R,3S,5R)-2-hydroxy-3,5-diphenylspiro[cyclohexane-4,2'-indene]-1,1',3'-trione (PubChem CID 102573460) has the molecular formula C26H20O4 and a molecular weight of 396.44 g/mol. Its IUPAC name is (2R,3S,5R)-2-hydroxy-3,5-diphenylspiro[cyclohexane-4,2'-indene]-1,1',3'-trione.
| Compound Name | (2R,3S,5R)-2-hydroxy-3,5-diphenylspiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
|---|---|
| PubChem CID | 102573460 |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (2R,3S,5R)-2-hydroxy-3,5-diphenylspiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
| SMILES | O=C1C[C@H](c2ccccc2)C2(C(=O)c3ccccc3C2=O)[C@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C26H20O4/c27-21-15-20(16-9-3-1-4-10-16)26(22(23(21)28)17-11-5-2-6-12-17)24(29)18-13-7-8-14-19(18)25(26)30/h1-14,20,22-23,28H,15H2/t20-,22-,23+/m1/s1 |
| InChIKey | PIKIQVCTASEPDA-MZYLBHOOSA-N |
| XLogP | 3.95 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|