C35H24F2O5 — CID 122391172
CID 122391172 (PubChem CID 122391172) has the molecular formula C35H24F2O5 and a molecular weight of 562.57 g/mol.
| Compound Name | CID 122391172 |
|---|---|
| PubChem CID | 122391172 |
| Molecular Formula | C35H24F2O5 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)C12C[C@H](CO)[C@@H](c1ccc(F)cc1)C1(C(=O)c3ccccc3C1=O)[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C35H24F2O5/c36-22-13-9-19(10-14-22)28-21(18-38)17-34(30(39)24-5-1-2-6-25(24)31(34)40)29(20-11-15-23(37)16-12-20)35(28)32(41)26-7-3-4-8-27(26)33(35)42/h1-16,21,28-29,38H,17-18H2/t21-,28-,29+/m1/s1 |
| InChIKey | WWLNBAQNWUSJGS-UEFPSYNTSA-N |
| XLogP | 5.98 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|