About CID 122391172
CID 122391172 (PubChem CID 122391172) has the molecular formula C35H24F2O5
and a molecular weight of 562.57 g/mol.
Molecular Properties
| Compound Name | CID 122391172 |
| PubChem CID | 122391172 |
| Molecular Formula | C35H24F2O5 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)C12C[C@H](CO)[C@@H](c1ccc(F)cc1)C1(C(=O)c3ccccc3C1=O)[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C35H24F2O5/c36-22-13-9-19(10-14-22)28-21(18-38)17-34(30(39)24-5-1-2-6-25(24)31(34)40)29(20-11-15-23(37)16-12-20)35(28)32(41)26-7-3-4-8-27(26)33(35)42/h1-16,21,28-29,38H,17-18H2/t21-,28-,29+/m1/s1 |
| InChIKey | WWLNBAQNWUSJGS-UEFPSYNTSA-N |
| XLogP | 5.98 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 122391172 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122391172?
The IUPAC name of CID 122391172 (CID 122391172) is not available.
What is the SMILES notation for CID 122391172?
The canonical SMILES for CID 122391172 is O=C1c2ccccc2C(=O)C12C[C@H](CO)[C@@H](c1ccc(F)cc1)C1(C(=O)c3ccccc3C1=O)[C@H]2c1ccc(F)cc1.
What is the InChIKey of CID 122391172?
The InChIKey is WWLNBAQNWUSJGS-UEFPSYNTSA-N. The full InChI is InChI=1S/C35H24F2O5/c36-22-13-9-19(10-14-22)28-21(18-38)17-34(30(39)24-5-1-2-6-25(24)31(34)40)29(20-11-15-23(37)16-12-20)35(28)32(41)26-7-3-4-8-27(26)33(35)42/h1-16,21,28-29,38H,17-18H2/t21-,28-,29+/m1/s1.
What are the key properties of CID 122391172?
CID 122391172 has a molecular weight of 562.57 g/mol, XLogP of 5.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122391172 is sourced from PubChem (CID 122391172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).