C21H18ClNO4 — CID 137322836
(6S,7R)-10-(4-chlorophenyl)-7-methyl-6-phenyl-2-oxa-3-azaspiro[4.5]decane-1,4,8-trione (PubChem CID 137322836) has the molecular formula C21H18ClNO4 and a molecular weight of 383.83 g/mol. Its IUPAC name is (6S,7R)-10-(4-chlorophenyl)-7-methyl-6-phenyl-2-oxa-3-azaspiro[4.5]decane-1,4,8-trione.
| Compound Name | (6S,7R)-10-(4-chlorophenyl)-7-methyl-6-phenyl-2-oxa-3-azaspiro[4.5]decane-1,4,8-trione |
|---|---|
| PubChem CID | 137322836 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (6S,7R)-10-(4-chlorophenyl)-7-methyl-6-phenyl-2-oxa-3-azaspiro[4.5]decane-1,4,8-trione |
| SMILES | C[C@H]1C(=O)CC(c2ccc(Cl)cc2)C2(C(=O)NOC2=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H18ClNO4/c1-12-17(24)11-16(13-7-9-15(22)10-8-13)21(19(25)23-27-20(21)26)18(12)14-5-3-2-4-6-14/h2-10,12,16,18H,11H2,1H3,(H,23,25)/t12-,16?,18-,21?/m0/s1 |
| InChIKey | POLVNYWOBMMCJM-VZZVUWLESA-N |
| XLogP | 3.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|