C26H31NO4 — CID 102454150
(3R,4aS,5S,6S,7R,8R)-5-methyl-3-(2-methylpropoxy)-7-nitro-6,8-diphenyl-4,4a,5,6,7,8-hexahydro-3H-isochromene (PubChem CID 102454150) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (3R,4aS,5S,6S,7R,8R)-5-methyl-3-(2-methylpropoxy)-7-nitro-6,8-diphenyl-4,4a,5,6,7,8-hexahydro-3H-isochromene.
| Compound Name | (3R,4aS,5S,6S,7R,8R)-5-methyl-3-(2-methylpropoxy)-7-nitro-6,8-diphenyl-4,4a,5,6,7,8-hexahydro-3H-isochromene |
|---|---|
| PubChem CID | 102454150 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (3R,4aS,5S,6S,7R,8R)-5-methyl-3-(2-methylpropoxy)-7-nitro-6,8-diphenyl-4,4a,5,6,7,8-hexahydro-3H-isochromene |
| SMILES | CC(C)CO[C@H]1C[C@@H]2C(=CO1)[C@@H](c1ccccc1)[C@H]([N+](=O)[O-])[C@H](c1ccccc1)[C@H]2C |
| InChI | InChI=1S/C26H31NO4/c1-17(2)15-30-23-14-21-18(3)24(19-10-6-4-7-11-19)26(27(28)29)25(22(21)16-31-23)20-12-8-5-9-13-20/h4-13,16-18,21,23-26H,14-15H2,1-3H3/t18-,21-,23+,24-,25+,26+/m0/s1 |
| InChIKey | BZLZOSWGEUKJBI-HXDQEZCZSA-N |
| XLogP | 5.77 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|