C23H23NO3S — CID 70128529
2-(3-ethenyl-5-phenyloxolan-2-yl)-1-(4-methylphenyl)sulfonylpyrrole (PubChem CID 70128529) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-(3-ethenyl-5-phenyloxolan-2-yl)-1-(4-methylphenyl)sulfonylpyrrole.
| Compound Name | 2-(3-ethenyl-5-phenyloxolan-2-yl)-1-(4-methylphenyl)sulfonylpyrrole |
|---|---|
| PubChem CID | 70128529 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-(3-ethenyl-5-phenyloxolan-2-yl)-1-(4-methylphenyl)sulfonylpyrrole |
| SMILES | C=CC1CC(c2ccccc2)OC1c1cccn1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H23NO3S/c1-3-18-16-22(19-8-5-4-6-9-19)27-23(18)21-10-7-15-24(21)28(25,26)20-13-11-17(2)12-14-20/h3-15,18,22-23H,1,16H2,2H3 |
| InChIKey | NDMAOUJHKRTKPH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|