C40H32F2N2O8 — CID 102126579
7,9-bis(4-fluoro-3-phenoxyphenyl)-3,3-dimethyl-10-nitro-11-phenyl-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione (PubChem CID 102126579) has the molecular formula C40H32F2N2O8 and a molecular weight of 706.70 g/mol. Its IUPAC name is 7,9-bis(4-fluoro-3-phenoxyphenyl)-3,3-dimethyl-10-nitro-11-phenyl-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione.
| Compound Name | 7,9-bis(4-fluoro-3-phenoxyphenyl)-3,3-dimethyl-10-nitro-11-phenyl-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione |
|---|---|
| PubChem CID | 102126579 |
| Molecular Formula | C40H32F2N2O8 |
| Molecular Weight | 706.70 g/mol |
| Exact Mass | 706.21 |
| IUPAC Name | 7,9-bis(4-fluoro-3-phenoxyphenyl)-3,3-dimethyl-10-nitro-11-phenyl-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione |
| SMILES | CC1(C)OC(=O)C2(C(=O)O1)C(c1ccc(F)c(Oc3ccccc3)c1)NC(c1ccc(F)c(Oc3ccccc3)c1)C([N+](=O)[O-])C2c1ccccc1 |
| InChI | InChI=1S/C40H32F2N2O8/c1-39(2)51-37(45)40(38(46)52-39)33(24-12-6-3-7-13-24)35(44(47)48)34(25-18-20-29(41)31(22-25)49-27-14-8-4-9-15-27)43-36(40)26-19-21-30(42)32(23-26)50-28-16-10-5-11-17-28/h3-23,33-36,43H,1-2H3 |
| InChIKey | CLGCIEFZUFBPAZ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|