C20H17Cl2N3O5 — CID 162646732
3-[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chlorophenyl)-3'-nitro-2-oxospiro[1H-indole-3,5'-pyrrolidine]-2'-yl]propanoic acid (PubChem CID 162646732) has the molecular formula C20H17Cl2N3O5 and a molecular weight of 450.28 g/mol. Its IUPAC name is 3-[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chlorophenyl)-3'-nitro-2-oxospiro[1H-indole-3,5'-pyrrolidine]-2'-yl]propanoic acid.
| Compound Name | 3-[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chlorophenyl)-3'-nitro-2-oxospiro[1H-indole-3,5'-pyrrolidine]-2'-yl]propanoic acid |
|---|---|
| PubChem CID | 162646732 |
| Molecular Formula | C20H17Cl2N3O5 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 3-[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chlorophenyl)-3'-nitro-2-oxospiro[1H-indole-3,5'-pyrrolidine]-2'-yl]propanoic acid |
| SMILES | O=C(O)CC[C@@H]1N[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@@H](c2cccc(Cl)c2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17Cl2N3O5/c21-11-3-1-2-10(8-11)17-18(25(29)30)14(6-7-16(26)27)24-20(17)13-5-4-12(22)9-15(13)23-19(20)28/h1-5,8-9,14,17-18,24H,6-7H2,(H,23,28)(H,26,27)/t14-,17-,18+,20+/m0/s1 |
| InChIKey | LRJUNDOXPKNLGN-FEUVXWNVSA-N |
| XLogP | 3.41 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|