C23H23Cl2N3O4 — CID 118439510
(3S,3'S,4'S,5'S)-6-chloro-3'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-5'-(2-hydroxyethyl)-4'-nitrospiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 118439510) has the molecular formula C23H23Cl2N3O4 and a molecular weight of 476.36 g/mol. Its IUPAC name is (3S,3'S,4'S,5'S)-6-chloro-3'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-5'-(2-hydroxyethyl)-4'-nitrospiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'S,4'S,5'S)-6-chloro-3'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-5'-(2-hydroxyethyl)-4'-nitrospiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 118439510 |
| Molecular Formula | C23H23Cl2N3O4 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | (3S,3'S,4'S,5'S)-6-chloro-3'-(3-chlorophenyl)-1'-(cyclopropylmethyl)-5'-(2-hydroxyethyl)-4'-nitrospiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2[C@@]12[C@@H](c1cccc(Cl)c1)[C@H]([N+](=O)[O-])[C@H](CCO)N2CC1CC1 |
| InChI | InChI=1S/C23H23Cl2N3O4/c24-15-3-1-2-14(10-15)20-21(28(31)32)19(8-9-29)27(12-13-4-5-13)23(20)17-7-6-16(25)11-18(17)26-22(23)30/h1-3,6-7,10-11,13,19-21,29H,4-5,8-9,12H2,(H,26,30)/t19-,20-,21+,23+/m0/s1 |
| InChIKey | DXNMWFMQACJCSF-NNXSRULWSA-N |
| XLogP | 4.05 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|