C25H26Cl2FN3O4 — CID 130376372
(3S,3'S,4'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclohexylmethyl)-5'-(hydroxymethyl)-4'-nitrospiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 130376372) has the molecular formula C25H26Cl2FN3O4 and a molecular weight of 522.40 g/mol. Its IUPAC name is (3S,3'S,4'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclohexylmethyl)-5'-(hydroxymethyl)-4'-nitrospiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'S,4'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclohexylmethyl)-5'-(hydroxymethyl)-4'-nitrospiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 130376372 |
| Molecular Formula | C25H26Cl2FN3O4 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | (3S,3'S,4'S,5'R)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclohexylmethyl)-5'-(hydroxymethyl)-4'-nitrospiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2[C@@]12[C@@H](c1cccc(Cl)c1F)[C@H]([N+](=O)[O-])[C@H](CO)N2CC1CCCCC1 |
| InChI | InChI=1S/C25H26Cl2FN3O4/c26-15-9-10-17-19(11-15)29-24(33)25(17)21(16-7-4-8-18(27)22(16)28)23(31(34)35)20(13-32)30(25)12-14-5-2-1-3-6-14/h4,7-11,14,20-21,23,32H,1-3,5-6,12-13H2,(H,29,33)/t20-,21-,23+,25+/m0/s1 |
| InChIKey | ZZJBSTCMQZYHSN-JKBGKOONSA-N |
| XLogP | 4.97 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|