C23H24Cl2FN3O2 — CID 130381341
(3S,3'S,4'S,5'R)-4'-amino-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-[(1S)-1-hydroxyethyl]spiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 130381341) has the molecular formula C23H24Cl2FN3O2 and a molecular weight of 464.37 g/mol. Its IUPAC name is (3S,3'S,4'S,5'R)-4'-amino-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-[(1S)-1-hydroxyethyl]spiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'S,4'S,5'R)-4'-amino-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-[(1S)-1-hydroxyethyl]spiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 130381341 |
| Molecular Formula | C23H24Cl2FN3O2 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (3S,3'S,4'S,5'R)-4'-amino-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-[(1S)-1-hydroxyethyl]spiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | C[C@H](O)[C@H]1[C@@H](N)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc3cc(Cl)ccc32)N1CC1CC1 |
| InChI | InChI=1S/C23H24Cl2FN3O2/c1-11(30)21-20(27)18(14-3-2-4-16(25)19(14)26)23(29(21)10-12-5-6-12)15-8-7-13(24)9-17(15)28-22(23)31/h2-4,7-9,11-12,18,20-21,30H,5-6,10,27H2,1H3,(H,28,31)/t11-,18-,20-,21-,23+/m0/s1 |
| InChIKey | WAYDGPFRRWZGGY-NQUQDFHUSA-N |
| XLogP | 3.87 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |