C32H31Cl2FN4O3 — CID 129264099
methyl 4-[(3aS,5S,6S,6aS)-6'-chloro-6-(3-chloro-2-fluorophenyl)-4-(cyclobutylmethyl)-2'-oxospiro[1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-5,3'-1H-indole]-2-yl]-3-aminobenzoate (PubChem CID 129264099) has the molecular formula C32H31Cl2FN4O3 and a molecular weight of 609.53 g/mol. Its IUPAC name is methyl 4-[(3aS,5S,6S,6aS)-6'-chloro-6-(3-chloro-2-fluorophenyl)-4-(cyclobutylmethyl)-2'-oxospiro[1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-5,3'-1H-indole]-2-yl]-3-aminobenzoate.
| Compound Name | methyl 4-[(3aS,5S,6S,6aS)-6'-chloro-6-(3-chloro-2-fluorophenyl)-4-(cyclobutylmethyl)-2'-oxospiro[1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-5,3'-1H-indole]-2-yl]-3-aminobenzoate |
|---|---|
| PubChem CID | 129264099 |
| Molecular Formula | C32H31Cl2FN4O3 |
| Molecular Weight | 609.53 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | methyl 4-[(3aS,5S,6S,6aS)-6'-chloro-6-(3-chloro-2-fluorophenyl)-4-(cyclobutylmethyl)-2'-oxospiro[1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-5,3'-1H-indole]-2-yl]-3-aminobenzoate |
| SMILES | COC(=O)c1ccc(C2C[C@H]3[C@@H](N2)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc4cc(Cl)ccc42)N3CC2CCC2)c(N)c1 |
| InChI | InChI=1S/C32H31Cl2FN4O3/c1-42-30(40)17-8-10-19(23(36)12-17)24-14-26-29(37-24)27(20-6-3-7-22(34)28(20)35)32(39(26)15-16-4-2-5-16)21-11-9-18(33)13-25(21)38-31(32)41/h3,6-13,16,24,26-27,29,37H,2,4-5,14-15,36H2,1H3,(H,38,41)/t24?,26-,27-,29+,32+/m0/s1 |
| InChIKey | FKLSSMKZPUDXIB-COFOVEDTSA-N |
| XLogP | 6.02 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|