C31H33Cl2FN4O4 — CID 158247675
methane;methyl 4-[(3aS,5S,6S,6aS)-6'-chloro-6-(3-chloro-2-fluorophenyl)-4-(2-methoxyethyl)-2'-oxospiro[1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-5,3'-1H-indole]-2-yl]-3-aminobenzoate (PubChem CID 158247675) has the molecular formula C31H33Cl2FN4O4 and a molecular weight of 615.53 g/mol. Its IUPAC name is methane;methyl 4-[(3aS,5S,6S,6aS)-6'-chloro-6-(3-chloro-2-fluorophenyl)-4-(2-methoxyethyl)-2'-oxospiro[1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-5,3'-1H-indole]-2-yl]-3-aminobenzoate.
| Compound Name | methane;methyl 4-[(3aS,5S,6S,6aS)-6'-chloro-6-(3-chloro-2-fluorophenyl)-4-(2-methoxyethyl)-2'-oxospiro[1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-5,3'-1H-indole]-2-yl]-3-aminobenzoate |
|---|---|
| PubChem CID | 158247675 |
| Molecular Formula | C31H33Cl2FN4O4 |
| Molecular Weight | 615.53 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | methane;methyl 4-[(3aS,5S,6S,6aS)-6'-chloro-6-(3-chloro-2-fluorophenyl)-4-(2-methoxyethyl)-2'-oxospiro[1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-5,3'-1H-indole]-2-yl]-3-aminobenzoate |
| SMILES | C.COCCN1[C@H]2CC(c3ccc(C(=O)OC)cc3N)N[C@H]2[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C30H29Cl2FN4O4.CH4/c1-40-11-10-37-24-14-22(17-8-6-15(12-21(17)34)28(38)41-2)35-27(24)25(18-4-3-5-20(32)26(18)33)30(37)19-9-7-16(31)13-23(19)36-29(30)39;/h3-9,12-13,22,24-25,27,35H,10-11,14,34H2,1-2H3,(H,36,39);1H4/t22?,24-,25-,27+,30+;/m0./s1 |
| InChIKey | GGICQHAYFVAOBL-VIXRFLSZSA-N |
| XLogP | 5.50 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|