C27H23Cl2FN4O4 — CID 129028571
methyl 4-[(3S,3'aS,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-1'-hydroxy-2-oxospiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole]-2'-yl]-3-aminobenzoate (PubChem CID 129028571) has the molecular formula C27H23Cl2FN4O4 and a molecular weight of 557.41 g/mol. Its IUPAC name is methyl 4-[(3S,3'aS,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-1'-hydroxy-2-oxospiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole]-2'-yl]-3-aminobenzoate.
| Compound Name | methyl 4-[(3S,3'aS,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-1'-hydroxy-2-oxospiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole]-2'-yl]-3-aminobenzoate |
|---|---|
| PubChem CID | 129028571 |
| Molecular Formula | C27H23Cl2FN4O4 |
| Molecular Weight | 557.41 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | methyl 4-[(3S,3'aS,6'S,6'aS)-6-chloro-6'-(3-chloro-2-fluorophenyl)-1'-hydroxy-2-oxospiro[1H-indole-3,5'-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole]-2'-yl]-3-aminobenzoate |
| SMILES | COC(=O)c1ccc(C2C[C@@H]3N[C@@]4(C(=O)Nc5cc(Cl)ccc54)[C@@H](c4cccc(Cl)c4F)[C@@H]3N2O)c(N)c1 |
| InChI | InChI=1S/C27H23Cl2FN4O4/c1-38-25(35)12-5-7-14(18(31)9-12)21-11-20-24(34(21)37)22(15-3-2-4-17(29)23(15)30)27(33-20)16-8-6-13(28)10-19(16)32-26(27)36/h2-10,20-22,24,33,37H,11,31H2,1H3,(H,32,36)/t20-,21?,22-,24+,27+/m0/s1 |
| InChIKey | VHUWDEBBLQACRA-AQQFDDBOSA-N |
| XLogP | 4.61 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|